C28H32FN3O2 — CID 70590386
1-(4-fluoro-2-hydroxyphenyl)-4-[4-[2-(N-phenylanilino)ethyl]piperazin-1-yl]butan-1-one (PubChem CID 70590386) has the molecular formula C28H32FN3O2 and a molecular weight of 461.58 g/mol. Its IUPAC name is 1-(4-fluoro-2-hydroxyphenyl)-4-[4-[2-(N-phenylanilino)ethyl]piperazin-1-yl]butan-1-one.
| Compound Name | 1-(4-fluoro-2-hydroxyphenyl)-4-[4-[2-(N-phenylanilino)ethyl]piperazin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 70590386 |
| Molecular Formula | C28H32FN3O2 |
| Molecular Weight | 461.58 g/mol |
| Exact Mass | 461.25 |
| IUPAC Name | 1-(4-fluoro-2-hydroxyphenyl)-4-[4-[2-(N-phenylanilino)ethyl]piperazin-1-yl]butan-1-one |
| SMILES | O=C(CCCN1CCN(CCN(c2ccccc2)c2ccccc2)CC1)c1ccc(F)cc1O |
| InChI | InChI=1S/C28H32FN3O2/c29-23-13-14-26(28(34)22-23)27(33)12-7-15-30-16-18-31(19-17-30)20-21-32(24-8-3-1-4-9-24)25-10-5-2-6-11-25/h1-6,8-11,13-14,22,34H,7,12,15-21H2 |
| InChIKey | QDTUHVPOKHZQJY-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 47.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.58 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |