C30H31F2NOS — CID 70533174
1-(2,4-difluorophenyl)-4-(1-phenylspiro[1H-2-benzothiophene-3,4'-piperidine]-1'-yl)butan-1-one;ethene (PubChem CID 70533174) has the molecular formula C30H31F2NOS and a molecular weight of 491.65 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-4-(1-phenylspiro[1H-2-benzothiophene-3,4'-piperidine]-1'-yl)butan-1-one;ethene.
| Compound Name | 1-(2,4-difluorophenyl)-4-(1-phenylspiro[1H-2-benzothiophene-3,4'-piperidine]-1'-yl)butan-1-one;ethene |
|---|---|
| PubChem CID | 70533174 |
| Molecular Formula | C30H31F2NOS |
| Molecular Weight | 491.65 g/mol |
| Exact Mass | 491.21 |
| IUPAC Name | 1-(2,4-difluorophenyl)-4-(1-phenylspiro[1H-2-benzothiophene-3,4'-piperidine]-1'-yl)butan-1-one;ethene |
| SMILES | C=C.O=C(CCCN1CCC2(CC1)SC(c1ccccc1)c1ccccc12)c1ccc(F)cc1F |
| InChI | InChI=1S/C28H27F2NOS.C2H4/c29-21-12-13-23(25(30)19-21)26(32)11-6-16-31-17-14-28(15-18-31)24-10-5-4-9-22(24)27(33-28)20-7-2-1-3-8-20;1-2/h1-5,7-10,12-13,19,27H,6,11,14-18H2;1-2H2 |
| InChIKey | ABQFMSZOWQDSRZ-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.65 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|