C32H37NO2 — CID 20572778
4-(4-benzhydrylidenepiperidin-1-yl)-1-(4-tert-butyl-2-hydroxyphenyl)butan-1-one (PubChem CID 20572778) has the molecular formula C32H37NO2 and a molecular weight of 467.65 g/mol. Its IUPAC name is 4-(4-benzhydrylidenepiperidin-1-yl)-1-(4-tert-butyl-2-hydroxyphenyl)butan-1-one.
| Compound Name | 4-(4-benzhydrylidenepiperidin-1-yl)-1-(4-tert-butyl-2-hydroxyphenyl)butan-1-one |
|---|---|
| PubChem CID | 20572778 |
| Molecular Formula | C32H37NO2 |
| Molecular Weight | 467.65 g/mol |
| Exact Mass | 467.28 |
| IUPAC Name | 4-(4-benzhydrylidenepiperidin-1-yl)-1-(4-tert-butyl-2-hydroxyphenyl)butan-1-one |
| SMILES | CC(C)(C)c1ccc(C(=O)CCCN2CCC(=C(c3ccccc3)c3ccccc3)CC2)c(O)c1 |
| InChI | InChI=1S/C32H37NO2/c1-32(2,3)27-16-17-28(30(35)23-27)29(34)15-10-20-33-21-18-26(19-22-33)31(24-11-6-4-7-12-24)25-13-8-5-9-14-25/h4-9,11-14,16-17,23,35H,10,15,18-22H2,1-3H3 |
| InChIKey | SQGIKTLFPYPMDG-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.65 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |