C29H44O4 — CID 57239197
1-[1-[(1S,4R)-4-[(1R,3aS,7aR)-4-[2-[(3R,5R)-3,5-dihydroxycyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-1-hydroxypent-2-enyl]cyclopropyl]propan-1-one (PubChem CID 57239197) has the molecular formula C29H44O4 and a molecular weight of 456.67 g/mol. Its IUPAC name is 1-[1-[(1S,4R)-4-[(1R,3aS,7aR)-4-[2-[(3R,5R)-3,5-dihydroxycyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-1-hydroxypent-2-enyl]cyclopropyl]propan-1-one.
| Compound Name | 1-[1-[(1S,4R)-4-[(1R,3aS,7aR)-4-[2-[(3R,5R)-3,5-dihydroxycyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-1-hydroxypent-2-enyl]cyclopropyl]propan-1-one |
|---|---|
| PubChem CID | 57239197 |
| Molecular Formula | C29H44O4 |
| Molecular Weight | 456.67 g/mol |
| Exact Mass | 456.32 |
| IUPAC Name | 1-[1-[(1S,4R)-4-[(1R,3aS,7aR)-4-[2-[(3R,5R)-3,5-dihydroxycyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-1-hydroxypent-2-enyl]cyclopropyl]propan-1-one |
| SMILES | CCC(=O)C1([C@@H](O)C=C[C@@H](C)[C@H]2CC[C@H]3C(=CC=C4C[C@@H](O)C[C@H](O)C4)CCC[C@]23C)CC1 |
| InChI | InChI=1S/C29H44O4/c1-4-26(32)29(14-15-29)27(33)12-7-19(2)24-10-11-25-21(6-5-13-28(24,25)3)9-8-20-16-22(30)18-23(31)17-20/h7-9,12,19,22-25,27,30-31,33H,4-6,10-11,13-18H2,1-3H3/t19-,22-,23-,24-,25+,27+,28-/m1/s1 |
| InChIKey | BZPGJMBBHFQADX-IXUKJJIDSA-N |
| XLogP | 5.27 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.67 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|