C30H48O5 — CID 56998457
propan-2-yl (3S,6R)-6-[(1R,3aS,7aR)-4-[2-[(3R,5R)-3,5-dihydroxycyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-3-hydroxy-2,2-dimethylhept-4-enoate (PubChem CID 56998457) has the molecular formula C30H48O5 and a molecular weight of 488.71 g/mol. Its IUPAC name is propan-2-yl (3S,6R)-6-[(1R,3aS,7aR)-4-[2-[(3R,5R)-3,5-dihydroxycyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-3-hydroxy-2,2-dimethylhept-4-enoate.
| Compound Name | propan-2-yl (3S,6R)-6-[(1R,3aS,7aR)-4-[2-[(3R,5R)-3,5-dihydroxycyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-3-hydroxy-2,2-dimethylhept-4-enoate |
|---|---|
| PubChem CID | 56998457 |
| Molecular Formula | C30H48O5 |
| Molecular Weight | 488.71 g/mol |
| Exact Mass | 488.35 |
| IUPAC Name | propan-2-yl (3S,6R)-6-[(1R,3aS,7aR)-4-[2-[(3R,5R)-3,5-dihydroxycyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-3-hydroxy-2,2-dimethylhept-4-enoate |
| SMILES | CC(C)OC(=O)C(C)(C)[C@@H](O)C=C[C@@H](C)[C@H]1CC[C@H]2C(=CC=C3C[C@@H](O)C[C@H](O)C3)CCC[C@]12C |
| InChI | InChI=1S/C30H48O5/c1-19(2)35-28(34)29(4,5)27(33)14-9-20(3)25-12-13-26-22(8-7-15-30(25,26)6)11-10-21-16-23(31)18-24(32)17-21/h9-11,14,19-20,23-27,31-33H,7-8,12-13,15-18H2,1-6H3/t20-,23-,24-,25-,26+,27+,30-/m1/s1 |
| InChIKey | NYIVZOCUUBQSIJ-UTTKMYMKSA-N |
| XLogP | 5.49 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.71 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|