C29H44O5 — CID 57306692
ethyl (3S)-6-[(1R,3aS,7aR)-4-[2-[(3R,5R)-3,5-dihydroxycyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-3-hydroxy-2,2-dimethylhepta-4,6-dienoate (PubChem CID 57306692) has the molecular formula C29H44O5 and a molecular weight of 472.67 g/mol. Its IUPAC name is ethyl (3S)-6-[(1R,3aS,7aR)-4-[2-[(3R,5R)-3,5-dihydroxycyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-3-hydroxy-2,2-dimethylhepta-4,6-dienoate.
| Compound Name | ethyl (3S)-6-[(1R,3aS,7aR)-4-[2-[(3R,5R)-3,5-dihydroxycyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-3-hydroxy-2,2-dimethylhepta-4,6-dienoate |
|---|---|
| PubChem CID | 57306692 |
| Molecular Formula | C29H44O5 |
| Molecular Weight | 472.67 g/mol |
| Exact Mass | 472.32 |
| IUPAC Name | ethyl (3S)-6-[(1R,3aS,7aR)-4-[2-[(3R,5R)-3,5-dihydroxycyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-3-hydroxy-2,2-dimethylhepta-4,6-dienoate |
| SMILES | C=C(C=C[C@H](O)C(C)(C)C(=O)OCC)[C@H]1CC[C@H]2C(=CC=C3C[C@@H](O)C[C@H](O)C3)CCC[C@]12C |
| InChI | InChI=1S/C29H44O5/c1-6-34-27(33)28(3,4)26(32)14-9-19(2)24-12-13-25-21(8-7-15-29(24,25)5)11-10-20-16-22(30)18-23(31)17-20/h9-11,14,22-26,30-32H,2,6-8,12-13,15-18H2,1,3-5H3/t22-,23-,24-,25+,26+,29-/m1/s1 |
| InChIKey | FBJQZGKGJDSANW-RZMMOFBXSA-N |
| XLogP | 5.02 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.67 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|