C28H44O5 — CID 91154441
[(1S)-1-[(1S,3aS,7aS)-4-[2-[(3R,5R)-3,5-dihydroxycyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]ethyl] 4-ethyl-4-hydroxyhex-2-enoate (PubChem CID 91154441) has the molecular formula C28H44O5 and a molecular weight of 460.66 g/mol. Its IUPAC name is [(1S)-1-[(1S,3aS,7aS)-4-[2-[(3R,5R)-3,5-dihydroxycyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]ethyl] 4-ethyl-4-hydroxyhex-2-enoate.
| Compound Name | [(1S)-1-[(1S,3aS,7aS)-4-[2-[(3R,5R)-3,5-dihydroxycyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]ethyl] 4-ethyl-4-hydroxyhex-2-enoate |
|---|---|
| PubChem CID | 91154441 |
| Molecular Formula | C28H44O5 |
| Molecular Weight | 460.66 g/mol |
| Exact Mass | 460.32 |
| IUPAC Name | [(1S)-1-[(1S,3aS,7aS)-4-[2-[(3R,5R)-3,5-dihydroxycyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]ethyl] 4-ethyl-4-hydroxyhex-2-enoate |
| SMILES | CCC(O)(C=CC(=O)O[C@@H](C)[C@H]1CC[C@H]2C(=CC=C3C[C@@H](O)C[C@H](O)C3)CCC[C@]12C)CC |
| InChI | InChI=1S/C28H44O5/c1-5-28(32,6-2)15-13-26(31)33-19(3)24-11-12-25-21(8-7-14-27(24,25)4)10-9-20-16-22(29)18-23(30)17-20/h9-10,13,15,19,22-25,29-30,32H,5-8,11-12,14,16-18H2,1-4H3/t19-,22+,23+,24+,25-,27+/m0/s1 |
| InChIKey | UXNPKOMAEZSZLI-QJUHDENJSA-N |
| XLogP | 5.00 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.66 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|