C29H46O5 — CID 25068971
[(1S)-1-[(1S,3aS,4E,7aS)-4-[2-[(3S,5R)-3,5-dihydroxy-4-methylcyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]ethyl] (E)-4-ethyl-4-hydroxyhex-2-enoate (PubChem CID 25068971) has the molecular formula C29H46O5 and a molecular weight of 474.68 g/mol. Its IUPAC name is [(1S)-1-[(1S,3aS,4E,7aS)-4-[2-[(3S,5R)-3,5-dihydroxy-4-methylcyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]ethyl] (E)-4-ethyl-4-hydroxyhex-2-enoate.
| Compound Name | [(1S)-1-[(1S,3aS,4E,7aS)-4-[2-[(3S,5R)-3,5-dihydroxy-4-methylcyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]ethyl] (E)-4-ethyl-4-hydroxyhex-2-enoate |
|---|---|
| PubChem CID | 25068971 |
| Molecular Formula | C29H46O5 |
| Molecular Weight | 474.68 g/mol |
| Exact Mass | 474.33 |
| IUPAC Name | [(1S)-1-[(1S,3aS,4E,7aS)-4-[2-[(3S,5R)-3,5-dihydroxy-4-methylcyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]ethyl] (E)-4-ethyl-4-hydroxyhex-2-enoate |
| SMILES | CCC(O)(/C=C/C(=O)O[C@@H](C)[C@H]1CC[C@H]2/C(=C/C=C3/C[C@@H](O)C(C)[C@@H](O)C3)CCC[C@]12C)CC |
| InChI | InChI=1S/C29H46O5/c1-6-29(33,7-2)16-14-27(32)34-20(4)23-12-13-24-22(9-8-15-28(23,24)5)11-10-21-17-25(30)19(3)26(31)18-21/h10-11,14,16,19-20,23-26,30-31,33H,6-9,12-13,15,17-18H2,1-5H3/b16-14+,21-10-,22-11+/t19?,20-,23+,24-,25+,26-,28+/m0/s1 |
| InChIKey | XKJYDLNTNLLWBQ-BKZUKHHHSA-N |
| XLogP | 5.25 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.68 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|