C32H48O5 — CID 57218274
butyl (3S)-6-[(1R,3aS,7aR)-4-[2-[(3S,5R)-3,5-dihydroxy-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-3-hydroxy-2,2-dimethylhepta-4,6-dienoate (PubChem CID 57218274) has the molecular formula C32H48O5 and a molecular weight of 512.73 g/mol. Its IUPAC name is butyl (3S)-6-[(1R,3aS,7aR)-4-[2-[(3S,5R)-3,5-dihydroxy-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-3-hydroxy-2,2-dimethylhepta-4,6-dienoate.
| Compound Name | butyl (3S)-6-[(1R,3aS,7aR)-4-[2-[(3S,5R)-3,5-dihydroxy-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-3-hydroxy-2,2-dimethylhepta-4,6-dienoate |
|---|---|
| PubChem CID | 57218274 |
| Molecular Formula | C32H48O5 |
| Molecular Weight | 512.73 g/mol |
| Exact Mass | 512.35 |
| IUPAC Name | butyl (3S)-6-[(1R,3aS,7aR)-4-[2-[(3S,5R)-3,5-dihydroxy-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-3-hydroxy-2,2-dimethylhepta-4,6-dienoate |
| SMILES | C=C(C=C[C@H](O)C(C)(C)C(=O)OCCCC)[C@H]1CC[C@H]2C(=CC=C3C[C@@H](O)C[C@H](O)C3=C)CCC[C@]12C |
| InChI | InChI=1S/C32H48O5/c1-7-8-18-37-30(36)31(4,5)29(35)16-11-21(2)26-14-15-27-23(10-9-17-32(26,27)6)12-13-24-19-25(33)20-28(34)22(24)3/h11-13,16,25-29,33-35H,2-3,7-10,14-15,17-20H2,1,4-6H3/t25-,26-,27+,28+,29+,32-/m1/s1 |
| InChIKey | PGUDHAHQGWPEML-XHYQUOLYSA-N |
| XLogP | 5.97 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.73 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|