C31H49O6P — CID 90982434
(7R)-7-[(1R,7aR)-4-[2-[(3S,5R)-3,5-dihydroxy-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-3-dimethoxyphosphoryl-3-ethyloct-5-en-4-one (PubChem CID 90982434) has the molecular formula C31H49O6P and a molecular weight of 548.70 g/mol. Its IUPAC name is (7R)-7-[(1R,7aR)-4-[2-[(3S,5R)-3,5-dihydroxy-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-3-dimethoxyphosphoryl-3-ethyloct-5-en-4-one.
| Compound Name | (7R)-7-[(1R,7aR)-4-[2-[(3S,5R)-3,5-dihydroxy-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-3-dimethoxyphosphoryl-3-ethyloct-5-en-4-one |
|---|---|
| PubChem CID | 90982434 |
| Molecular Formula | C31H49O6P |
| Molecular Weight | 548.70 g/mol |
| Exact Mass | 548.33 |
| IUPAC Name | (7R)-7-[(1R,7aR)-4-[2-[(3S,5R)-3,5-dihydroxy-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-3-dimethoxyphosphoryl-3-ethyloct-5-en-4-one |
| SMILES | C=C1C(=CC=C2CCC[C@@]3(C)C2CC[C@@H]3[C@H](C)C=CC(=O)C(CC)(CC)P(=O)(OC)OC)C[C@@H](O)C[C@@H]1O |
| InChI | InChI=1S/C31H49O6P/c1-8-31(9-2,38(35,36-6)37-7)29(34)17-12-21(3)26-15-16-27-23(11-10-18-30(26,27)5)13-14-24-19-25(32)20-28(33)22(24)4/h12-14,17,21,25-28,32-33H,4,8-11,15-16,18-20H2,1-3,5-7H3/t21-,25-,26-,27?,28+,30-/m1/s1 |
| InChIKey | QWECGYCFBWNPRM-NDEJTZHZSA-N |
| XLogP | 6.93 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.70 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|