C28H43O6P — CID 91453711
(4R)-4-[(1R,7aR)-4-[2-[(3S,5R)-3,5-dihydroxy-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-1-diethoxyphosphorylpent-2-en-1-one (PubChem CID 91453711) has the molecular formula C28H43O6P and a molecular weight of 506.62 g/mol. Its IUPAC name is (4R)-4-[(1R,7aR)-4-[2-[(3S,5R)-3,5-dihydroxy-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-1-diethoxyphosphorylpent-2-en-1-one.
| Compound Name | (4R)-4-[(1R,7aR)-4-[2-[(3S,5R)-3,5-dihydroxy-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-1-diethoxyphosphorylpent-2-en-1-one |
|---|---|
| PubChem CID | 91453711 |
| Molecular Formula | C28H43O6P |
| Molecular Weight | 506.62 g/mol |
| Exact Mass | 506.28 |
| IUPAC Name | (4R)-4-[(1R,7aR)-4-[2-[(3S,5R)-3,5-dihydroxy-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-1-diethoxyphosphorylpent-2-en-1-one |
| SMILES | C=C1C(=CC=C2CCC[C@@]3(C)C2CC[C@@H]3[C@H](C)C=CC(=O)P(=O)(OCC)OCC)C[C@@H](O)C[C@@H]1O |
| InChI | InChI=1S/C28H43O6P/c1-6-33-35(32,34-7-2)27(31)15-10-19(3)24-13-14-25-21(9-8-16-28(24,25)5)11-12-22-17-23(29)18-26(30)20(22)4/h10-12,15,19,23-26,29-30H,4,6-9,13-14,16-18H2,1-3,5H3/t19-,23-,24-,25?,26+,28-/m1/s1 |
| InChIKey | YMHNSYCZZVFDAG-RHUBAGRRSA-N |
| XLogP | 6.11 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.62 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|