C27H31N3O4 — CID 57239448
3-[1-[1-(1H-indol-3-yl)ethyl]-8-(3-methylbutyl)-3,5-dioxo-2H-1,4-benzodiazepin-4-yl]propanoic acid (PubChem CID 57239448) has the molecular formula C27H31N3O4 and a molecular weight of 461.56 g/mol. Its IUPAC name is 3-[1-[1-(1H-indol-3-yl)ethyl]-8-(3-methylbutyl)-3,5-dioxo-2H-1,4-benzodiazepin-4-yl]propanoic acid.
| Compound Name | 3-[1-[1-(1H-indol-3-yl)ethyl]-8-(3-methylbutyl)-3,5-dioxo-2H-1,4-benzodiazepin-4-yl]propanoic acid |
|---|---|
| PubChem CID | 57239448 |
| Molecular Formula | C27H31N3O4 |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.23 |
| IUPAC Name | 3-[1-[1-(1H-indol-3-yl)ethyl]-8-(3-methylbutyl)-3,5-dioxo-2H-1,4-benzodiazepin-4-yl]propanoic acid |
| SMILES | CC(C)CCc1ccc2c(c1)N(C(C)c1c[nH]c3ccccc13)CC(=O)N(CCC(=O)O)C2=O |
| InChI | InChI=1S/C27H31N3O4/c1-17(2)8-9-19-10-11-21-24(14-19)30(16-25(31)29(27(21)34)13-12-26(32)33)18(3)22-15-28-23-7-5-4-6-20(22)23/h4-7,10-11,14-15,17-18,28H,8-9,12-13,16H2,1-3H3,(H,32,33) |
| InChIKey | VTKQUDUBMWDLRT-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 93.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|