C28H33N3O4 — CID 57181614
4-[1-[1-(1H-indol-3-yl)ethyl]-7-(3-methylbutyl)-3,5-dioxo-2H-1,4-benzodiazepin-4-yl]butanoic acid (PubChem CID 57181614) has the molecular formula C28H33N3O4 and a molecular weight of 475.59 g/mol. Its IUPAC name is 4-[1-[1-(1H-indol-3-yl)ethyl]-7-(3-methylbutyl)-3,5-dioxo-2H-1,4-benzodiazepin-4-yl]butanoic acid.
| Compound Name | 4-[1-[1-(1H-indol-3-yl)ethyl]-7-(3-methylbutyl)-3,5-dioxo-2H-1,4-benzodiazepin-4-yl]butanoic acid |
|---|---|
| PubChem CID | 57181614 |
| Molecular Formula | C28H33N3O4 |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.25 |
| IUPAC Name | 4-[1-[1-(1H-indol-3-yl)ethyl]-7-(3-methylbutyl)-3,5-dioxo-2H-1,4-benzodiazepin-4-yl]butanoic acid |
| SMILES | CC(C)CCc1ccc2c(c1)C(=O)N(CCCC(=O)O)C(=O)CN2C(C)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C28H33N3O4/c1-18(2)10-11-20-12-13-25-22(15-20)28(35)30(14-6-9-27(33)34)26(32)17-31(25)19(3)23-16-29-24-8-5-4-7-21(23)24/h4-5,7-8,12-13,15-16,18-19,29H,6,9-11,14,17H2,1-3H3,(H,33,34) |
| InChIKey | WWNWBDGQOSYCCW-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 93.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|