C27H33F3O4S3 — CID 57241243
3-[2-carboxyethylsulfanyl-[2-[7-[4-(trifluoromethyl)phenyl]sulfanylheptyl]phenyl]methyl]sulfanylpropanoic acid (PubChem CID 57241243) has the molecular formula C27H33F3O4S3 and a molecular weight of 574.75 g/mol. Its IUPAC name is 3-[2-carboxyethylsulfanyl-[2-[7-[4-(trifluoromethyl)phenyl]sulfanylheptyl]phenyl]methyl]sulfanylpropanoic acid.
| Compound Name | 3-[2-carboxyethylsulfanyl-[2-[7-[4-(trifluoromethyl)phenyl]sulfanylheptyl]phenyl]methyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 57241243 |
| Molecular Formula | C27H33F3O4S3 |
| Molecular Weight | 574.75 g/mol |
| Exact Mass | 574.15 |
| IUPAC Name | 3-[2-carboxyethylsulfanyl-[2-[7-[4-(trifluoromethyl)phenyl]sulfanylheptyl]phenyl]methyl]sulfanylpropanoic acid |
| SMILES | O=C(O)CCSC(SCCC(=O)O)c1ccccc1CCCCCCCSc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C27H33F3O4S3/c28-27(29,30)21-11-13-22(14-12-21)35-17-7-3-1-2-4-8-20-9-5-6-10-23(20)26(36-18-15-24(31)32)37-19-16-25(33)34/h5-6,9-14,26H,1-4,7-8,15-19H2,(H,31,32)(H,33,34) |
| InChIKey | JJLZUXYHXSEVBQ-UHFFFAOYSA-N |
| XLogP | 8.41 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.75 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|