C23H18F3NO2 — CID 57241767
(2-amino-2,3-dihydro-1H-inden-5-yl) 2-[4-(trifluoromethyl)phenyl]benzoate (PubChem CID 57241767) has the molecular formula C23H18F3NO2 and a molecular weight of 397.40 g/mol. Its IUPAC name is (2-amino-2,3-dihydro-1H-inden-5-yl) 2-[4-(trifluoromethyl)phenyl]benzoate.
| Compound Name | (2-amino-2,3-dihydro-1H-inden-5-yl) 2-[4-(trifluoromethyl)phenyl]benzoate |
|---|---|
| PubChem CID | 57241767 |
| Molecular Formula | C23H18F3NO2 |
| Molecular Weight | 397.40 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | (2-amino-2,3-dihydro-1H-inden-5-yl) 2-[4-(trifluoromethyl)phenyl]benzoate |
| SMILES | NC1Cc2ccc(OC(=O)c3ccccc3-c3ccc(C(F)(F)F)cc3)cc2C1 |
| InChI | InChI=1S/C23H18F3NO2/c24-23(25,26)17-8-5-14(6-9-17)20-3-1-2-4-21(20)22(28)29-19-10-7-15-11-18(27)12-16(15)13-19/h1-10,13,18H,11-12,27H2 |
| InChIKey | CQAQQWAHSDMIJB-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.40 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|