About 1H-indol-5-yl methanesulfinate
1H-indol-5-yl methanesulfinate (PubChem CID 57242710) has the molecular formula C9H9NO2S
and a molecular weight of 195.24 g/mol. Its IUPAC name is 1H-indol-5-yl methanesulfinate.
Molecular Properties
| Compound Name | 1H-indol-5-yl methanesulfinate |
| PubChem CID | 57242710 |
| Molecular Formula | C9H9NO2S |
| Molecular Weight | 195.24 g/mol |
| Exact Mass | 195.04 |
| IUPAC Name | 1H-indol-5-yl methanesulfinate |
| SMILES | CS(=O)Oc1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C9H9NO2S/c1-13(11)12-8-2-3-9-7(6-8)4-5-10-9/h2-6,10H,1H3 |
| InChIKey | WEFMDRNQJSKKEA-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.24 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1H-indol-5-yl methanesulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-indol-5-yl methanesulfinate?
The IUPAC name of 1H-indol-5-yl methanesulfinate (CID 57242710) is 1H-indol-5-yl methanesulfinate.
What is the SMILES notation for 1H-indol-5-yl methanesulfinate?
The canonical SMILES for 1H-indol-5-yl methanesulfinate is CS(=O)Oc1ccc2[nH]ccc2c1.
What is the InChIKey of 1H-indol-5-yl methanesulfinate?
The InChIKey is WEFMDRNQJSKKEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO2S/c1-13(11)12-8-2-3-9-7(6-8)4-5-10-9/h2-6,10H,1H3.
What are the key properties of 1H-indol-5-yl methanesulfinate?
1H-indol-5-yl methanesulfinate has a molecular weight of 195.24 g/mol, XLogP of 1.84, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-indol-5-yl methanesulfinate is sourced from PubChem (CID 57242710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).