4,6,8-trimethylnonan-2-yl hydrogen sulfate

C12H26O4S — CID 57244252

IUPAC4,6,8-trimethylnonan-2-yl hydrogen sulfate
SMILESCC(C)CC(C)CC(C)CC(C)OS(=O)(=O)O
InChIInChI=1S/C12H26O4S/c1-9(2)6-10(3)7-11(4)8-12(5)16-17(13,14)15/h9-12H,6-8H2,1-5H3,(H,13,14,15)
InChIKeyUWBRGGWRJHOCTH-UHFFFAOYSA-N
MW266.40 g/mol
LogP3.29
Rot. Bonds8

About 4,6,8-trimethylnonan-2-yl hydrogen sulfate

4,6,8-trimethylnonan-2-yl hydrogen sulfate (PubChem CID 57244252) has the molecular formula C12H26O4S and a molecular weight of 266.40 g/mol. Its IUPAC name is 4,6,8-trimethylnonan-2-yl hydrogen sulfate.

Molecular Properties

Compound Name4,6,8-trimethylnonan-2-yl hydrogen sulfate
PubChem CID57244252
Molecular FormulaC12H26O4S
Molecular Weight266.40 g/mol
Exact Mass266.16
IUPAC Name4,6,8-trimethylnonan-2-yl hydrogen sulfate
SMILESCC(C)CC(C)CC(C)CC(C)OS(=O)(=O)O
InChIInChI=1S/C12H26O4S/c1-9(2)6-10(3)7-11(4)8-12(5)16-17(13,14)15/h9-12H,6-8H2,1-5H3,(H,13,14,15)
InChIKeyUWBRGGWRJHOCTH-UHFFFAOYSA-N
XLogP3.29
TPSA63.60 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds8
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500266.40
LogP ≤ 53.29
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 4,6,8-trimethylnonan-2-yl hydrogen sulfate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4,6,8-trimethylnonan-2-yl hydrogen sulfate?
The IUPAC name of 4,6,8-trimethylnonan-2-yl hydrogen sulfate (CID 57244252) is 4,6,8-trimethylnonan-2-yl hydrogen sulfate.
What is the SMILES notation for 4,6,8-trimethylnonan-2-yl hydrogen sulfate?
The canonical SMILES for 4,6,8-trimethylnonan-2-yl hydrogen sulfate is CC(C)CC(C)CC(C)CC(C)OS(=O)(=O)O.
What is the InChIKey of 4,6,8-trimethylnonan-2-yl hydrogen sulfate?
The InChIKey is UWBRGGWRJHOCTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26O4S/c1-9(2)6-10(3)7-11(4)8-12(5)16-17(13,14)15/h9-12H,6-8H2,1-5H3,(H,13,14,15).
What are the key properties of 4,6,8-trimethylnonan-2-yl hydrogen sulfate?
4,6,8-trimethylnonan-2-yl hydrogen sulfate has a molecular weight of 266.40 g/mol, XLogP of 3.29, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6,8-trimethylnonan-2-yl hydrogen sulfate is sourced from PubChem (CID 57244252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).