C13H17NO — CID 57245659
2,3,4,4a,5,6,6a,10-octahydro-1H-benzo[f]quinolin-7-one (PubChem CID 57245659) has the molecular formula C13H17NO and a molecular weight of 203.28 g/mol. Its IUPAC name is 2,3,4,4a,5,6,6a,10-octahydro-1H-benzo[f]quinolin-7-one.
| Compound Name | 2,3,4,4a,5,6,6a,10-octahydro-1H-benzo[f]quinolin-7-one |
|---|---|
| PubChem CID | 57245659 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 2,3,4,4a,5,6,6a,10-octahydro-1H-benzo[f]quinolin-7-one |
| SMILES | O=C1C=CCC2=C3CCCNC3CCC12 |
| InChI | InChI=1S/C13H17NO/c15-13-5-1-3-9-10-4-2-8-14-12(10)7-6-11(9)13/h1,5,11-12,14H,2-4,6-8H2 |
| InChIKey | IFQMYGKFZXMJBO-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|