C21H39NO — CID 57248492
N-cyclohexyl-2,3-dimethyltridec-2-enamide (PubChem CID 57248492) has the molecular formula C21H39NO and a molecular weight of 321.55 g/mol. Its IUPAC name is N-cyclohexyl-2,3-dimethyltridec-2-enamide.
| Compound Name | N-cyclohexyl-2,3-dimethyltridec-2-enamide |
|---|---|
| PubChem CID | 57248492 |
| Molecular Formula | C21H39NO |
| Molecular Weight | 321.55 g/mol |
| Exact Mass | 321.30 |
| IUPAC Name | N-cyclohexyl-2,3-dimethyltridec-2-enamide |
| SMILES | CCCCCCCCCCC(C)=C(C)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C21H39NO/c1-4-5-6-7-8-9-10-12-15-18(2)19(3)21(23)22-20-16-13-11-14-17-20/h20H,4-17H2,1-3H3,(H,22,23) |
| InChIKey | VXPWJURULVDOEZ-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.55 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|