C11H7ClN2O — CID 57249324
2,12-diazatricyclo[6.3.1.04,12]dodeca-1(11),3,5,7,9-pentaene-6-carbonyl chloride (PubChem CID 57249324) has the molecular formula C11H7ClN2O and a molecular weight of 218.64 g/mol. Its IUPAC name is 2,12-diazatricyclo[6.3.1.04,12]dodeca-1(11),3,5,7,9-pentaene-6-carbonyl chloride.
| Compound Name | 2,12-diazatricyclo[6.3.1.04,12]dodeca-1(11),3,5,7,9-pentaene-6-carbonyl chloride |
|---|---|
| PubChem CID | 57249324 |
| Molecular Formula | C11H7ClN2O |
| Molecular Weight | 218.64 g/mol |
| Exact Mass | 218.02 |
| IUPAC Name | 2,12-diazatricyclo[6.3.1.04,12]dodeca-1(11),3,5,7,9-pentaene-6-carbonyl chloride |
| SMILES | O=C(Cl)C1=CC2=CNC3=CC=CC(=C1)N23 |
| InChI | InChI=1S/C11H7ClN2O/c12-11(15)7-4-8-2-1-3-10-13-6-9(5-7)14(8)10/h1-6,13H |
| InChIKey | QFUQQVSXSJIOAA-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.64 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|