C11H9N3O — CID 54091461
2,12-diazatricyclo[6.3.1.04,12]dodeca-1(11),3,5,7,9-pentaene-6-carboxamide (PubChem CID 54091461) has the molecular formula C11H9N3O and a molecular weight of 199.21 g/mol. Its IUPAC name is 2,12-diazatricyclo[6.3.1.04,12]dodeca-1(11),3,5,7,9-pentaene-6-carboxamide.
| Compound Name | 2,12-diazatricyclo[6.3.1.04,12]dodeca-1(11),3,5,7,9-pentaene-6-carboxamide |
|---|---|
| PubChem CID | 54091461 |
| Molecular Formula | C11H9N3O |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.07 |
| IUPAC Name | 2,12-diazatricyclo[6.3.1.04,12]dodeca-1(11),3,5,7,9-pentaene-6-carboxamide |
| SMILES | NC(=O)C1=CC2=CNC3=CC=CC(=C1)N23 |
| InChI | InChI=1S/C11H9N3O/c12-11(15)7-4-8-2-1-3-10-13-6-9(5-7)14(8)10/h1-6,13H,(H2,12,15) |
| InChIKey | MUDUICGFTKVSQP-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |