C19H20N2O3 — CID 57250308
N-[5-(4-tert-butylphenyl)furan-2-yl]-2-cyano-3-oxobutanamide (PubChem CID 57250308) has the molecular formula C19H20N2O3 and a molecular weight of 324.38 g/mol. Its IUPAC name is N-[5-(4-tert-butylphenyl)furan-2-yl]-2-cyano-3-oxobutanamide.
| Compound Name | N-[5-(4-tert-butylphenyl)furan-2-yl]-2-cyano-3-oxobutanamide |
|---|---|
| PubChem CID | 57250308 |
| Molecular Formula | C19H20N2O3 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | N-[5-(4-tert-butylphenyl)furan-2-yl]-2-cyano-3-oxobutanamide |
| SMILES | CC(=O)C(C#N)C(=O)Nc1ccc(-c2ccc(C(C)(C)C)cc2)o1 |
| InChI | InChI=1S/C19H20N2O3/c1-12(22)15(11-20)18(23)21-17-10-9-16(24-17)13-5-7-14(8-6-13)19(2,3)4/h5-10,15H,1-4H3,(H,21,23) |
| InChIKey | QLOSFBOKNGBKCS-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 83.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|