C17H19NO — CID 57250330
6-methoxy-1-methyl-2-(4-methylphenyl)-2,3-dihydroindole (PubChem CID 57250330) has the molecular formula C17H19NO and a molecular weight of 253.34 g/mol. Its IUPAC name is 6-methoxy-1-methyl-2-(4-methylphenyl)-2,3-dihydroindole.
| Compound Name | 6-methoxy-1-methyl-2-(4-methylphenyl)-2,3-dihydroindole |
|---|---|
| PubChem CID | 57250330 |
| Molecular Formula | C17H19NO |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | 6-methoxy-1-methyl-2-(4-methylphenyl)-2,3-dihydroindole |
| SMILES | COc1ccc2c(c1)N(C)C(c1ccc(C)cc1)C2 |
| InChI | InChI=1S/C17H19NO/c1-12-4-6-13(7-5-12)16-10-14-8-9-15(19-3)11-17(14)18(16)2/h4-9,11,16H,10H2,1-3H3 |
| InChIKey | YGJOCYSMUZTKTK-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |