C13H18N2O — CID 105472853
3-methoxy-6,7,8,9,9a,10-hexahydropyrido[1,2-a]indol-8-amine (PubChem CID 105472853) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is 3-methoxy-6,7,8,9,9a,10-hexahydropyrido[1,2-a]indol-8-amine.
| Compound Name | 3-methoxy-6,7,8,9,9a,10-hexahydropyrido[1,2-a]indol-8-amine |
|---|---|
| PubChem CID | 105472853 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | 3-methoxy-6,7,8,9,9a,10-hexahydropyrido[1,2-a]indol-8-amine |
| SMILES | COc1ccc2c(c1)N1CCC(N)CC1C2 |
| InChI | InChI=1S/C13H18N2O/c1-16-12-3-2-9-6-11-7-10(14)4-5-15(11)13(9)8-12/h2-3,8,10-11H,4-7,14H2,1H3 |
| InChIKey | SXQUMWKXHNXWES-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |