C12H15ClN2 — CID 105480128
2-chloro-6,7,8,9,9a,10-hexahydropyrido[1,2-a]indol-8-amine (PubChem CID 105480128) has the molecular formula C12H15ClN2 and a molecular weight of 222.72 g/mol. Its IUPAC name is 2-chloro-6,7,8,9,9a,10-hexahydropyrido[1,2-a]indol-8-amine.
| Compound Name | 2-chloro-6,7,8,9,9a,10-hexahydropyrido[1,2-a]indol-8-amine |
|---|---|
| PubChem CID | 105480128 |
| Molecular Formula | C12H15ClN2 |
| Molecular Weight | 222.72 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | 2-chloro-6,7,8,9,9a,10-hexahydropyrido[1,2-a]indol-8-amine |
| SMILES | NC1CCN2c3ccc(Cl)cc3CC2C1 |
| InChI | InChI=1S/C12H15ClN2/c13-9-1-2-12-8(5-9)6-11-7-10(14)3-4-15(11)12/h1-2,5,10-11H,3-4,6-7,14H2 |
| InChIKey | OKTXIAMTDIUJRI-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.72 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |