C13H18N2 — CID 105454751
3-methyl-6,7,8,9,9a,10-hexahydropyrido[1,2-a]indol-8-amine (PubChem CID 105454751) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is 3-methyl-6,7,8,9,9a,10-hexahydropyrido[1,2-a]indol-8-amine.
| Compound Name | 3-methyl-6,7,8,9,9a,10-hexahydropyrido[1,2-a]indol-8-amine |
|---|---|
| PubChem CID | 105454751 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | 3-methyl-6,7,8,9,9a,10-hexahydropyrido[1,2-a]indol-8-amine |
| SMILES | Cc1ccc2c(c1)N1CCC(N)CC1C2 |
| InChI | InChI=1S/C13H18N2/c1-9-2-3-10-7-12-8-11(14)4-5-15(12)13(10)6-9/h2-3,6,11-12H,4-5,7-8,14H2,1H3 |
| InChIKey | VXDCOTSGVOKREN-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |