About 7-O-tert-butyl 1-O-(2,5-dihydroxypyrrol-1-yl) (2S)-2,6-diaminoheptanedioate
7-O-tert-butyl 1-O-(2,5-dihydroxypyrrol-1-yl) (2S)-2,6-diaminoheptanedioate (PubChem CID 57253272) has the molecular formula C15H25N3O6
and a molecular weight of 343.38 g/mol. Its IUPAC name is 7-O-tert-butyl 1-O-(2,5-dihydroxypyrrol-1-yl) (2S)-2,6-diaminoheptanedioate.
Molecular Properties
| Compound Name | 7-O-tert-butyl 1-O-(2,5-dihydroxypyrrol-1-yl) (2S)-2,6-diaminoheptanedioate |
| PubChem CID | 57253272 |
| Molecular Formula | C15H25N3O6 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | 7-O-tert-butyl 1-O-(2,5-dihydroxypyrrol-1-yl) (2S)-2,6-diaminoheptanedioate |
| SMILES | CC(C)(C)OC(=O)C(N)CCC[C@H](N)C(=O)On1c(O)ccc1O |
| InChI | InChI=1S/C15H25N3O6/c1-15(2,3)23-13(21)9(16)5-4-6-10(17)14(22)24-18-11(19)7-8-12(18)20/h7-10,19-20H,4-6,16-17H2,1-3H3/t9?,10-/m0/s1 |
| InChIKey | DJKPHGNUBFQBLR-AXDSSHIGSA-N |
| XLogP | 0.02 |
| TPSA | 150.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze 7-O-tert-butyl 1-O-(2,5-dihydroxypyrrol-1-yl) (2S)-2,6-diaminoheptanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-O-tert-butyl 1-O-(2,5-dihydroxypyrrol-1-yl) (2S)-2,6-diaminoheptanedioate?
The IUPAC name of 7-O-tert-butyl 1-O-(2,5-dihydroxypyrrol-1-yl) (2S)-2,6-diaminoheptanedioate (CID 57253272) is 7-O-tert-butyl 1-O-(2,5-dihydroxypyrrol-1-yl) (2S)-2,6-diaminoheptanedioate.
What is the SMILES notation for 7-O-tert-butyl 1-O-(2,5-dihydroxypyrrol-1-yl) (2S)-2,6-diaminoheptanedioate?
The canonical SMILES for 7-O-tert-butyl 1-O-(2,5-dihydroxypyrrol-1-yl) (2S)-2,6-diaminoheptanedioate is CC(C)(C)OC(=O)C(N)CCC[C@H](N)C(=O)On1c(O)ccc1O.
What is the InChIKey of 7-O-tert-butyl 1-O-(2,5-dihydroxypyrrol-1-yl) (2S)-2,6-diaminoheptanedioate?
The InChIKey is DJKPHGNUBFQBLR-AXDSSHIGSA-N. The full InChI is InChI=1S/C15H25N3O6/c1-15(2,3)23-13(21)9(16)5-4-6-10(17)14(22)24-18-11(19)7-8-12(18)20/h7-10,19-20H,4-6,16-17H2,1-3H3/t9?,10-/m0/s1.
What are the key properties of 7-O-tert-butyl 1-O-(2,5-dihydroxypyrrol-1-yl) (2S)-2,6-diaminoheptanedioate?
7-O-tert-butyl 1-O-(2,5-dihydroxypyrrol-1-yl) (2S)-2,6-diaminoheptanedioate has a molecular weight of 343.38 g/mol, XLogP of 0.02, 7 rotatable bonds, 4 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 7-O-tert-butyl 1-O-(2,5-dihydroxypyrrol-1-yl) (2S)-2,6-diaminoheptanedioate is sourced from PubChem (CID 57253272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).