C15H13NO3 — CID 57255220
4-hydroxy-N-(2-phenylacetyl)benzamide (PubChem CID 57255220) has the molecular formula C15H13NO3 and a molecular weight of 255.27 g/mol. Its IUPAC name is 4-hydroxy-N-(2-phenylacetyl)benzamide.
| Compound Name | 4-hydroxy-N-(2-phenylacetyl)benzamide |
|---|---|
| PubChem CID | 57255220 |
| Molecular Formula | C15H13NO3 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | 4-hydroxy-N-(2-phenylacetyl)benzamide |
| SMILES | O=C(Cc1ccccc1)NC(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C15H13NO3/c17-13-8-6-12(7-9-13)15(19)16-14(18)10-11-4-2-1-3-5-11/h1-9,17H,10H2,(H,16,18,19) |
| InChIKey | XGRVUCYOZCYWQQ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |