C15H10ClF3N2S2 — CID 57256747
7-chloro-3-[[3-(trifluoromethyl)phenyl]methylsulfanyl]-2H-1,2,4-benzothiadiazine (PubChem CID 57256747) has the molecular formula C15H10ClF3N2S2 and a molecular weight of 374.84 g/mol. Its IUPAC name is 7-chloro-3-[[3-(trifluoromethyl)phenyl]methylsulfanyl]-2H-1,2,4-benzothiadiazine.
| Compound Name | 7-chloro-3-[[3-(trifluoromethyl)phenyl]methylsulfanyl]-2H-1,2,4-benzothiadiazine |
|---|---|
| PubChem CID | 57256747 |
| Molecular Formula | C15H10ClF3N2S2 |
| Molecular Weight | 374.84 g/mol |
| Exact Mass | 373.99 |
| IUPAC Name | 7-chloro-3-[[3-(trifluoromethyl)phenyl]methylsulfanyl]-2H-1,2,4-benzothiadiazine |
| SMILES | FC(F)(F)c1cccc(CSC2=Nc3ccc(Cl)cc3SN2)c1 |
| InChI | InChI=1S/C15H10ClF3N2S2/c16-11-4-5-12-13(7-11)23-21-14(20-12)22-8-9-2-1-3-10(6-9)15(17,18)19/h1-7H,8H2,(H,20,21) |
| InChIKey | UPTFPMZBMSWCCS-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.84 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|