C17H26ClF3N2OS — CID 2797331
4,4,7,7-tetramethyl-2-[[3-(trifluoromethyl)phenyl]methylsulfanyl]-5,6-dihydro-1H-1,3-diazepine;hydrate;hydrochloride (PubChem CID 2797331) has the molecular formula C17H26ClF3N2OS and a molecular weight of 398.92 g/mol. Its IUPAC name is 4,4,7,7-tetramethyl-2-[[3-(trifluoromethyl)phenyl]methylsulfanyl]-5,6-dihydro-1H-1,3-diazepine;hydrate;hydrochloride.
| Compound Name | 4,4,7,7-tetramethyl-2-[[3-(trifluoromethyl)phenyl]methylsulfanyl]-5,6-dihydro-1H-1,3-diazepine;hydrate;hydrochloride |
|---|---|
| PubChem CID | 2797331 |
| Molecular Formula | C17H26ClF3N2OS |
| Molecular Weight | 398.92 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | 4,4,7,7-tetramethyl-2-[[3-(trifluoromethyl)phenyl]methylsulfanyl]-5,6-dihydro-1H-1,3-diazepine;hydrate;hydrochloride |
| SMILES | CC1(C)CCC(C)(C)NC(SCc2cccc(C(F)(F)F)c2)=N1.Cl.O |
| InChI | InChI=1S/C17H23F3N2S.ClH.H2O/c1-15(2)8-9-16(3,4)22-14(21-15)23-11-12-6-5-7-13(10-12)17(18,19)20;;/h5-7,10H,8-9,11H2,1-4H3,(H,21,22);1H;1H2 |
| InChIKey | SEYDJHBEQAPVSR-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.92 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |