C16H20N2O17 — CID 57257993
2-(1,2-dicarboxyethylamino)-2-[1,2-dicarboxyethyl-(1,2-dicarboxy-2-hydroxyethyl)amino]butanedioic acid (PubChem CID 57257993) has the molecular formula C16H20N2O17 and a molecular weight of 512.33 g/mol. Its IUPAC name is 2-(1,2-dicarboxyethylamino)-2-[1,2-dicarboxyethyl-(1,2-dicarboxy-2-hydroxyethyl)amino]butanedioic acid.
| Compound Name | 2-(1,2-dicarboxyethylamino)-2-[1,2-dicarboxyethyl-(1,2-dicarboxy-2-hydroxyethyl)amino]butanedioic acid |
|---|---|
| PubChem CID | 57257993 |
| Molecular Formula | C16H20N2O17 |
| Molecular Weight | 512.33 g/mol |
| Exact Mass | 512.08 |
| IUPAC Name | 2-(1,2-dicarboxyethylamino)-2-[1,2-dicarboxyethyl-(1,2-dicarboxy-2-hydroxyethyl)amino]butanedioic acid |
| SMILES | O=C(O)CC(NC(CC(=O)O)(C(=O)O)N(C(CC(=O)O)C(=O)O)C(C(=O)O)C(O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C16H20N2O17/c19-6(20)1-4(11(26)27)17-16(15(34)35,3-8(23)24)18(5(12(28)29)2-7(21)22)9(13(30)31)10(25)14(32)33/h4-5,9-10,17,25H,1-3H2,(H,19,20)(H,21,22)(H,23,24)(H,26,27)(H,28,29)(H,30,31)(H,32,33)(H,34,35) |
| InChIKey | MKVUBDMAFRKPRJ-UHFFFAOYSA-N |
| XLogP | -4.11 |
| TPSA | 333.90 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.33 |
| LogP ≤ 5 | -4.11 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|