C23H28ClN5O5 — CID 57258140
3-[4-[[2-[[(2S)-3-(2-chloro-3-nitrophenoxy)-2-hydroxypropyl]amino]-2-methylpropyl]amino]phenyl]-4,5-dihydro-1H-pyridazin-6-one (PubChem CID 57258140) has the molecular formula C23H28ClN5O5 and a molecular weight of 489.96 g/mol. Its IUPAC name is 3-[4-[[2-[[(2S)-3-(2-chloro-3-nitrophenoxy)-2-hydroxypropyl]amino]-2-methylpropyl]amino]phenyl]-4,5-dihydro-1H-pyridazin-6-one.
| Compound Name | 3-[4-[[2-[[(2S)-3-(2-chloro-3-nitrophenoxy)-2-hydroxypropyl]amino]-2-methylpropyl]amino]phenyl]-4,5-dihydro-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 57258140 |
| Molecular Formula | C23H28ClN5O5 |
| Molecular Weight | 489.96 g/mol |
| Exact Mass | 489.18 |
| IUPAC Name | 3-[4-[[2-[[(2S)-3-(2-chloro-3-nitrophenoxy)-2-hydroxypropyl]amino]-2-methylpropyl]amino]phenyl]-4,5-dihydro-1H-pyridazin-6-one |
| SMILES | CC(C)(CNc1ccc(C2=NNC(=O)CC2)cc1)NC[C@H](O)COc1cccc([N+](=O)[O-])c1Cl |
| InChI | InChI=1S/C23H28ClN5O5/c1-23(2,14-25-16-8-6-15(7-9-16)18-10-11-21(31)28-27-18)26-12-17(30)13-34-20-5-3-4-19(22(20)24)29(32)33/h3-9,17,25-26,30H,10-14H2,1-2H3,(H,28,31)/t17-/m0/s1 |
| InChIKey | MOUDUSRFNOAHAD-KRWDZBQOSA-N |
| XLogP | 3.08 |
| TPSA | 138.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.96 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|