C29H41NO2SSi — CID 57258756
tri(propan-2-yl)-[[2-[4-(2-pyrrolidin-1-ylethoxy)phenyl]-1-benzothiophen-6-yl]oxy]silane (PubChem CID 57258756) has the molecular formula C29H41NO2SSi and a molecular weight of 495.81 g/mol. Its IUPAC name is tri(propan-2-yl)-[[2-[4-(2-pyrrolidin-1-ylethoxy)phenyl]-1-benzothiophen-6-yl]oxy]silane.
| Compound Name | tri(propan-2-yl)-[[2-[4-(2-pyrrolidin-1-ylethoxy)phenyl]-1-benzothiophen-6-yl]oxy]silane |
|---|---|
| PubChem CID | 57258756 |
| Molecular Formula | C29H41NO2SSi |
| Molecular Weight | 495.81 g/mol |
| Exact Mass | 495.26 |
| IUPAC Name | tri(propan-2-yl)-[[2-[4-(2-pyrrolidin-1-ylethoxy)phenyl]-1-benzothiophen-6-yl]oxy]silane |
| SMILES | CC(C)[Si](Oc1ccc2cc(-c3ccc(OCCN4CCCC4)cc3)sc2c1)(C(C)C)C(C)C |
| InChI | InChI=1S/C29H41NO2SSi/c1-21(2)34(22(3)4,23(5)6)32-27-14-11-25-19-28(33-29(25)20-27)24-9-12-26(13-10-24)31-18-17-30-15-7-8-16-30/h9-14,19-23H,7-8,15-18H2,1-6H3 |
| InChIKey | YFTWZKLKHOEYTO-UHFFFAOYSA-N |
| XLogP | 8.60 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.81 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|