C17H11F2N — CID 57258860
6,7-difluoro-2-(2-phenylethenyl)quinoline (PubChem CID 57258860) has the molecular formula C17H11F2N and a molecular weight of 267.28 g/mol. Its IUPAC name is 6,7-difluoro-2-(2-phenylethenyl)quinoline.
| Compound Name | 6,7-difluoro-2-(2-phenylethenyl)quinoline |
|---|---|
| PubChem CID | 57258860 |
| Molecular Formula | C17H11F2N |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | 6,7-difluoro-2-(2-phenylethenyl)quinoline |
| SMILES | Fc1cc2ccc(C=Cc3ccccc3)nc2cc1F |
| InChI | InChI=1S/C17H11F2N/c18-15-10-13-7-9-14(20-17(13)11-16(15)19)8-6-12-4-2-1-3-5-12/h1-11H |
| InChIKey | BGYCPCHGGCFSIV-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |