C20H15F2NO — CID 67646619
3-[3-[2-(6,7-difluoroquinolin-2-yl)ethenyl]phenyl]prop-1-en-1-ol (PubChem CID 67646619) has the molecular formula C20H15F2NO and a molecular weight of 323.34 g/mol. Its IUPAC name is 3-[3-[2-(6,7-difluoroquinolin-2-yl)ethenyl]phenyl]prop-1-en-1-ol.
| Compound Name | 3-[3-[2-(6,7-difluoroquinolin-2-yl)ethenyl]phenyl]prop-1-en-1-ol |
|---|---|
| PubChem CID | 67646619 |
| Molecular Formula | C20H15F2NO |
| Molecular Weight | 323.34 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | 3-[3-[2-(6,7-difluoroquinolin-2-yl)ethenyl]phenyl]prop-1-en-1-ol |
| SMILES | OC=CCc1cccc(C=Cc2ccc3cc(F)c(F)cc3n2)c1 |
| InChI | InChI=1S/C20H15F2NO/c21-18-12-16-7-9-17(23-20(16)13-19(18)22)8-6-15-4-1-3-14(11-15)5-2-10-24/h1-4,6-13,24H,5H2 |
| InChIKey | UZZUNTPRFPLISN-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.34 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|