C32H38N2O5 — CID 57258963
[4-[(1R,2S)-1-hydroxy-2-(4-hydroxy-4-phenylpiperidin-1-yl)propyl]phenyl] 4-(morpholin-4-ylmethyl)benzoate (PubChem CID 57258963) has the molecular formula C32H38N2O5 and a molecular weight of 530.67 g/mol. Its IUPAC name is [4-[(1R,2S)-1-hydroxy-2-(4-hydroxy-4-phenylpiperidin-1-yl)propyl]phenyl] 4-(morpholin-4-ylmethyl)benzoate.
| Compound Name | [4-[(1R,2S)-1-hydroxy-2-(4-hydroxy-4-phenylpiperidin-1-yl)propyl]phenyl] 4-(morpholin-4-ylmethyl)benzoate |
|---|---|
| PubChem CID | 57258963 |
| Molecular Formula | C32H38N2O5 |
| Molecular Weight | 530.67 g/mol |
| Exact Mass | 530.28 |
| IUPAC Name | [4-[(1R,2S)-1-hydroxy-2-(4-hydroxy-4-phenylpiperidin-1-yl)propyl]phenyl] 4-(morpholin-4-ylmethyl)benzoate |
| SMILES | C[C@@H]([C@H](O)c1ccc(OC(=O)c2ccc(CN3CCOCC3)cc2)cc1)N1CCC(O)(c2ccccc2)CC1 |
| InChI | InChI=1S/C32H38N2O5/c1-24(34-17-15-32(37,16-18-34)28-5-3-2-4-6-28)30(35)26-11-13-29(14-12-26)39-31(36)27-9-7-25(8-10-27)23-33-19-21-38-22-20-33/h2-14,24,30,35,37H,15-23H2,1H3/t24-,30-/m0/s1 |
| InChIKey | DBHRHUYQDLLURH-NGQVCNFZSA-N |
| XLogP | 4.14 |
| TPSA | 82.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.67 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|