C15H15Cl3 — CID 57258999
1-(4,4,4-trichloro-2-methylbutan-2-yl)naphthalene (PubChem CID 57258999) has the molecular formula C15H15Cl3 and a molecular weight of 301.64 g/mol. Its IUPAC name is 1-(4,4,4-trichloro-2-methylbutan-2-yl)naphthalene.
| Compound Name | 1-(4,4,4-trichloro-2-methylbutan-2-yl)naphthalene |
|---|---|
| PubChem CID | 57258999 |
| Molecular Formula | C15H15Cl3 |
| Molecular Weight | 301.64 g/mol |
| Exact Mass | 300.02 |
| IUPAC Name | 1-(4,4,4-trichloro-2-methylbutan-2-yl)naphthalene |
| SMILES | CC(C)(CC(Cl)(Cl)Cl)c1cccc2ccccc12 |
| InChI | InChI=1S/C15H15Cl3/c1-14(2,10-15(16,17)18)13-9-5-7-11-6-3-4-8-12(11)13/h3-9H,10H2,1-2H3 |
| InChIKey | IEEWGIZVECNRKT-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.64 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|