C14H19NO2S2 — CID 57259029
S-[(6,6-dimethyl-4-oxo-3-propan-2-yl-5,7-dihydro-2-benzothiophen-1-yl)] carbamothioate (PubChem CID 57259029) has the molecular formula C14H19NO2S2 and a molecular weight of 297.44 g/mol. Its IUPAC name is S-[(6,6-dimethyl-4-oxo-3-propan-2-yl-5,7-dihydro-2-benzothiophen-1-yl)] carbamothioate.
| Compound Name | S-[(6,6-dimethyl-4-oxo-3-propan-2-yl-5,7-dihydro-2-benzothiophen-1-yl)] carbamothioate |
|---|---|
| PubChem CID | 57259029 |
| Molecular Formula | C14H19NO2S2 |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | S-[(6,6-dimethyl-4-oxo-3-propan-2-yl-5,7-dihydro-2-benzothiophen-1-yl)] carbamothioate |
| SMILES | CC(C)c1sc(SC(N)=O)c2c1C(=O)CC(C)(C)C2 |
| InChI | InChI=1S/C14H19NO2S2/c1-7(2)11-10-8(12(18-11)19-13(15)17)5-14(3,4)6-9(10)16/h7H,5-6H2,1-4H3,(H2,15,17) |
| InChIKey | CDTJHDMQJSGSBF-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|