C59H58N4O5S2 — CID 57259247
2,4-bis[1-(benzenesulfonyl)-6-methylindol-2-yl]-1,5-bis(1-benzylpiperidin-4-yl)penta-1,4-dien-3-one (PubChem CID 57259247) has the molecular formula C59H58N4O5S2 and a molecular weight of 967.27 g/mol. Its IUPAC name is 2,4-bis[1-(benzenesulfonyl)-6-methylindol-2-yl]-1,5-bis(1-benzylpiperidin-4-yl)penta-1,4-dien-3-one.
| Compound Name | 2,4-bis[1-(benzenesulfonyl)-6-methylindol-2-yl]-1,5-bis(1-benzylpiperidin-4-yl)penta-1,4-dien-3-one |
|---|---|
| PubChem CID | 57259247 |
| Molecular Formula | C59H58N4O5S2 |
| Molecular Weight | 967.27 g/mol |
| Exact Mass | 966.38 |
| IUPAC Name | 2,4-bis[1-(benzenesulfonyl)-6-methylindol-2-yl]-1,5-bis(1-benzylpiperidin-4-yl)penta-1,4-dien-3-one |
| SMILES | Cc1ccc2cc(C(=CC3CCN(Cc4ccccc4)CC3)C(=O)C(=CC3CCN(Cc4ccccc4)CC3)c3cc4ccc(C)cc4n3S(=O)(=O)c3ccccc3)n(S(=O)(=O)c3ccccc3)c2c1 |
| InChI | InChI=1S/C59H58N4O5S2/c1-43-23-25-49-39-57(62(55(49)35-43)69(65,66)51-19-11-5-12-20-51)53(37-45-27-31-60(32-28-45)41-47-15-7-3-8-16-47)59(64)54(38-46-29-33-61(34-30-46)42-48-17-9-4-10-18-48)58-40-50-26-24-44(2)36-56(50)63(58)70(67,68)52-21-13-6-14-22-52/h3-26,35-40,45-46H,27-34,41-42H2,1-2H3 |
| InChIKey | ZAAFRCKGHSMELN-UHFFFAOYSA-N |
| XLogP | 11.55 |
| TPSA | 101.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 967.27 |
| LogP ≤ 5 | 11.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|