C7H6NO4+ — CID 57261306
3H-pyridin-1-ium-3,5-dicarboxylic acid (PubChem CID 57261306) has the molecular formula C7H6NO4+ and a molecular weight of 168.13 g/mol. Its IUPAC name is 3H-pyridin-1-ium-3,5-dicarboxylic acid.
| Compound Name | 3H-pyridin-1-ium-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 57261306 |
| Molecular Formula | C7H6NO4+ |
| Molecular Weight | 168.13 g/mol |
| Exact Mass | 168.03 |
| IUPAC Name | 3H-pyridin-1-ium-3,5-dicarboxylic acid |
| SMILES | O=C(O)C1=CC(C(=O)O)C=[N+]=C1 |
| InChI | InChI=1S/C7H5NO4/c9-6(10)4-1-5(7(11)12)3-8-2-4/h1-4H,(H-,9,10,11,12)/p+1 |
| InChIKey | IYRDGKQDIZJZMN-UHFFFAOYSA-O |
| XLogP | -1.08 |
| TPSA | 88.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.13 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|