About 2-pyrrolidin-2-ylethyl 2-[1-(4-chlorophenyl)ethenylamino]oxyacetate
2-pyrrolidin-2-ylethyl 2-[1-(4-chlorophenyl)ethenylamino]oxyacetate (PubChem CID 57264503) has the molecular formula C16H21ClN2O3
and a molecular weight of 324.81 g/mol. Its IUPAC name is 2-pyrrolidin-2-ylethyl 2-[1-(4-chlorophenyl)ethenylamino]oxyacetate.
Molecular Properties
| Compound Name | 2-pyrrolidin-2-ylethyl 2-[1-(4-chlorophenyl)ethenylamino]oxyacetate |
| PubChem CID | 57264503 |
| Molecular Formula | C16H21ClN2O3 |
| Molecular Weight | 324.81 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | 2-pyrrolidin-2-ylethyl 2-[1-(4-chlorophenyl)ethenylamino]oxyacetate |
| SMILES | C=C(NOCC(=O)OCCC1CCCN1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H21ClN2O3/c1-12(13-4-6-14(17)7-5-13)19-22-11-16(20)21-10-8-15-3-2-9-18-15/h4-7,15,18-19H,1-3,8-11H2 |
| InChIKey | OGMHHHAGCMIWOA-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.81 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-pyrrolidin-2-ylethyl 2-[1-(4-chlorophenyl)ethenylamino]oxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyrrolidin-2-ylethyl 2-[1-(4-chlorophenyl)ethenylamino]oxyacetate?
The IUPAC name of 2-pyrrolidin-2-ylethyl 2-[1-(4-chlorophenyl)ethenylamino]oxyacetate (CID 57264503) is 2-pyrrolidin-2-ylethyl 2-[1-(4-chlorophenyl)ethenylamino]oxyacetate.
What is the SMILES notation for 2-pyrrolidin-2-ylethyl 2-[1-(4-chlorophenyl)ethenylamino]oxyacetate?
The canonical SMILES for 2-pyrrolidin-2-ylethyl 2-[1-(4-chlorophenyl)ethenylamino]oxyacetate is C=C(NOCC(=O)OCCC1CCCN1)c1ccc(Cl)cc1.
What is the InChIKey of 2-pyrrolidin-2-ylethyl 2-[1-(4-chlorophenyl)ethenylamino]oxyacetate?
The InChIKey is OGMHHHAGCMIWOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21ClN2O3/c1-12(13-4-6-14(17)7-5-13)19-22-11-16(20)21-10-8-15-3-2-9-18-15/h4-7,15,18-19H,1-3,8-11H2.
What are the key properties of 2-pyrrolidin-2-ylethyl 2-[1-(4-chlorophenyl)ethenylamino]oxyacetate?
2-pyrrolidin-2-ylethyl 2-[1-(4-chlorophenyl)ethenylamino]oxyacetate has a molecular weight of 324.81 g/mol, XLogP of 2.52, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyrrolidin-2-ylethyl 2-[1-(4-chlorophenyl)ethenylamino]oxyacetate is sourced from PubChem (CID 57264503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).