C10H7NO3S2 — CID 57264705
3-(4-hydroxy-2-sulfanylidene-1,3-thiazol-3-yl)benzoic acid (PubChem CID 57264705) has the molecular formula C10H7NO3S2 and a molecular weight of 253.30 g/mol. Its IUPAC name is 3-(4-hydroxy-2-sulfanylidene-1,3-thiazol-3-yl)benzoic acid.
| Compound Name | 3-(4-hydroxy-2-sulfanylidene-1,3-thiazol-3-yl)benzoic acid |
|---|---|
| PubChem CID | 57264705 |
| Molecular Formula | C10H7NO3S2 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 252.99 |
| IUPAC Name | 3-(4-hydroxy-2-sulfanylidene-1,3-thiazol-3-yl)benzoic acid |
| SMILES | O=C(O)c1cccc(-n2c(O)csc2=S)c1 |
| InChI | InChI=1S/C10H7NO3S2/c12-8-5-16-10(15)11(8)7-3-1-2-6(4-7)9(13)14/h1-5,12H,(H,13,14) |
| InChIKey | ZHAKSCDRDBCGSQ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|