C21H35ClO — CID 57265015
(8S,9S,10S,13R,14S,17R)-17-(2-chloroethyl)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-2-ol (PubChem CID 57265015) has the molecular formula C21H35ClO and a molecular weight of 338.96 g/mol. Its IUPAC name is (8S,9S,10S,13R,14S,17R)-17-(2-chloroethyl)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-2-ol.
| Compound Name | (8S,9S,10S,13R,14S,17R)-17-(2-chloroethyl)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-2-ol |
|---|---|
| PubChem CID | 57265015 |
| Molecular Formula | C21H35ClO |
| Molecular Weight | 338.96 g/mol |
| Exact Mass | 338.24 |
| IUPAC Name | (8S,9S,10S,13R,14S,17R)-17-(2-chloroethyl)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-2-ol |
| SMILES | C[C@]12CC[C@H]3[C@@H](CCC4CCC(O)C[C@@]43C)[C@@H]1CC[C@@H]2CCCl |
| InChI | InChI=1S/C21H35ClO/c1-20-11-9-19-17(18(20)8-5-15(20)10-12-22)7-4-14-3-6-16(23)13-21(14,19)2/h14-19,23H,3-13H2,1-2H3/t14?,15-,16?,17+,18+,19+,20-,21+/m1/s1 |
| InChIKey | WBEGUMBZHVXBHD-LJEUJQQESA-N |
| XLogP | 5.64 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.96 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|