C22H38O2 — CID 68519842
(3S,5S,8S,9S,10S,13R,14S,17S)-17-ethyl-3,10,13-trimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-2,3-diol (PubChem CID 68519842) has the molecular formula C22H38O2 and a molecular weight of 334.54 g/mol. Its IUPAC name is (3S,5S,8S,9S,10S,13R,14S,17S)-17-ethyl-3,10,13-trimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-2,3-diol.
| Compound Name | (3S,5S,8S,9S,10S,13R,14S,17S)-17-ethyl-3,10,13-trimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-2,3-diol |
|---|---|
| PubChem CID | 68519842 |
| Molecular Formula | C22H38O2 |
| Molecular Weight | 334.54 g/mol |
| Exact Mass | 334.29 |
| IUPAC Name | (3S,5S,8S,9S,10S,13R,14S,17S)-17-ethyl-3,10,13-trimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-2,3-diol |
| SMILES | CC[C@H]1CC[C@H]2[C@@H]3CC[C@H]4C[C@](C)(O)C(O)C[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C22H38O2/c1-5-14-7-9-17-16-8-6-15-12-22(4,24)19(23)13-21(15,3)18(16)10-11-20(14,17)2/h14-19,23-24H,5-13H2,1-4H3/t14-,15-,16-,17-,18-,19?,20+,21-,22-/m0/s1 |
| InChIKey | MHZFRRGJHQAFRJ-PPAYDNLLSA-N |
| XLogP | 4.78 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.54 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |