C14H13N3O6S2 — CID 572652
N-[4-(4-formamido-3-sulfamoylphenyl)sulfonylphenyl]formamide (PubChem CID 572652) has the molecular formula C14H13N3O6S2 and a molecular weight of 383.41 g/mol. Its IUPAC name is N-[4-(4-formamido-3-sulfamoylphenyl)sulfonylphenyl]formamide.
| Compound Name | N-[4-(4-formamido-3-sulfamoylphenyl)sulfonylphenyl]formamide |
|---|---|
| PubChem CID | 572652 |
| Molecular Formula | C14H13N3O6S2 |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 383.02 |
| IUPAC Name | N-[4-(4-formamido-3-sulfamoylphenyl)sulfonylphenyl]formamide |
| SMILES | NS(=O)(=O)c1cc(S(=O)(=O)c2ccc(NC=O)cc2)ccc1NC=O |
| InChI | InChI=1S/C14H13N3O6S2/c15-25(22,23)14-7-12(5-6-13(14)17-9-19)24(20,21)11-3-1-10(2-4-11)16-8-18/h1-9H,(H,16,18)(H,17,19)(H2,15,22,23) |
| InChIKey | KKUHEVHODMKHFH-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 152.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|