C18H27NO2 — CID 57266090
[(3S,4aR,6S,8aS)-6-[(4-methoxyphenyl)methyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-3-yl]methanol (PubChem CID 57266090) has the molecular formula C18H27NO2 and a molecular weight of 289.42 g/mol. Its IUPAC name is [(3S,4aR,6S,8aS)-6-[(4-methoxyphenyl)methyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-3-yl]methanol.
| Compound Name | [(3S,4aR,6S,8aS)-6-[(4-methoxyphenyl)methyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-3-yl]methanol |
|---|---|
| PubChem CID | 57266090 |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | [(3S,4aR,6S,8aS)-6-[(4-methoxyphenyl)methyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-3-yl]methanol |
| SMILES | COc1ccc(C[C@H]2CC[C@@H]3NC[C@@H](CO)C[C@H]3C2)cc1 |
| InChI | InChI=1S/C18H27NO2/c1-21-17-5-2-13(3-6-17)8-14-4-7-18-16(9-14)10-15(12-20)11-19-18/h2-3,5-6,14-16,18-20H,4,7-12H2,1H3/t14-,15+,16-,18+/m1/s1 |
| InChIKey | FRQGCHAEYBOTGO-HPFXQQBRSA-N |
| XLogP | 2.62 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |