C26H33NO3 — CID 70104995
(3R,4aR,6R,8aR)-3-(hydroxymethyl)-6-[(4-methoxyphenyl)methyl]-1-(2-phenylethyl)-3,4,4a,5,6,7,8,8a-octahydroquinolin-2-one (PubChem CID 70104995) has the molecular formula C26H33NO3 and a molecular weight of 407.55 g/mol. Its IUPAC name is (3R,4aR,6R,8aR)-3-(hydroxymethyl)-6-[(4-methoxyphenyl)methyl]-1-(2-phenylethyl)-3,4,4a,5,6,7,8,8a-octahydroquinolin-2-one.
| Compound Name | (3R,4aR,6R,8aR)-3-(hydroxymethyl)-6-[(4-methoxyphenyl)methyl]-1-(2-phenylethyl)-3,4,4a,5,6,7,8,8a-octahydroquinolin-2-one |
|---|---|
| PubChem CID | 70104995 |
| Molecular Formula | C26H33NO3 |
| Molecular Weight | 407.55 g/mol |
| Exact Mass | 407.25 |
| IUPAC Name | (3R,4aR,6R,8aR)-3-(hydroxymethyl)-6-[(4-methoxyphenyl)methyl]-1-(2-phenylethyl)-3,4,4a,5,6,7,8,8a-octahydroquinolin-2-one |
| SMILES | COc1ccc(C[C@@H]2CC[C@@H]3[C@H](C2)C[C@H](CO)C(=O)N3CCc2ccccc2)cc1 |
| InChI | InChI=1S/C26H33NO3/c1-30-24-10-7-20(8-11-24)15-21-9-12-25-22(16-21)17-23(18-28)26(29)27(25)14-13-19-5-3-2-4-6-19/h2-8,10-11,21-23,25,28H,9,12-18H2,1H3/t21-,22+,23+,25+/m0/s1 |
| InChIKey | KAESDAJCSNPYTP-XJTUCQONSA-N |
| XLogP | 4.11 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.55 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |