C20H21NO6 — CID 57266657
diethyl 1-acetyloxy-3,4-dihydropyrido[1,2-a]indole-2,3-dicarboxylate (PubChem CID 57266657) has the molecular formula C20H21NO6 and a molecular weight of 371.39 g/mol. Its IUPAC name is diethyl 1-acetyloxy-3,4-dihydropyrido[1,2-a]indole-2,3-dicarboxylate.
| Compound Name | diethyl 1-acetyloxy-3,4-dihydropyrido[1,2-a]indole-2,3-dicarboxylate |
|---|---|
| PubChem CID | 57266657 |
| Molecular Formula | C20H21NO6 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | diethyl 1-acetyloxy-3,4-dihydropyrido[1,2-a]indole-2,3-dicarboxylate |
| SMILES | CCOC(=O)C1=C(OC(C)=O)c2cc3ccccn3c2CC1C(=O)OCC |
| InChI | InChI=1S/C20H21NO6/c1-4-25-19(23)15-11-16-14(10-13-8-6-7-9-21(13)16)18(27-12(3)22)17(15)20(24)26-5-2/h6-10,15H,4-5,11H2,1-3H3 |
| InChIKey | OLIUUCZFYJEASK-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 83.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|