C11H19F3O4S2 — CID 57267445
[methyl-(2-oxocyclohexyl)-propyl-λ4-sulfanyl] trifluoromethanesulfonate (PubChem CID 57267445) has the molecular formula C11H19F3O4S2 and a molecular weight of 336.40 g/mol. Its IUPAC name is [methyl-(2-oxocyclohexyl)-propyl-λ4-sulfanyl] trifluoromethanesulfonate.
| Compound Name | [methyl-(2-oxocyclohexyl)-propyl-λ4-sulfanyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 57267445 |
| Molecular Formula | C11H19F3O4S2 |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | [methyl-(2-oxocyclohexyl)-propyl-λ4-sulfanyl] trifluoromethanesulfonate |
| SMILES | CCCS(C)(OS(=O)(=O)C(F)(F)F)C1CCCCC1=O |
| InChI | InChI=1S/C11H19F3O4S2/c1-3-8-19(2,10-7-5-4-6-9(10)15)18-20(16,17)11(12,13)14/h10H,3-8H2,1-2H3 |
| InChIKey | TYMHUNOEOCZNFY-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|