C26H35NO4S2 — CID 57269829
5-[2-(4-aminophenyl)ethyl]-3-[3-tert-butyl-4-(hydroxymethyl)-5-methylthiophen-2-yl]sulfanyl-6-propan-2-yloxane-2,4-dione (PubChem CID 57269829) has the molecular formula C26H35NO4S2 and a molecular weight of 489.70 g/mol. Its IUPAC name is 5-[2-(4-aminophenyl)ethyl]-3-[3-tert-butyl-4-(hydroxymethyl)-5-methylthiophen-2-yl]sulfanyl-6-propan-2-yloxane-2,4-dione.
| Compound Name | 5-[2-(4-aminophenyl)ethyl]-3-[3-tert-butyl-4-(hydroxymethyl)-5-methylthiophen-2-yl]sulfanyl-6-propan-2-yloxane-2,4-dione |
|---|---|
| PubChem CID | 57269829 |
| Molecular Formula | C26H35NO4S2 |
| Molecular Weight | 489.70 g/mol |
| Exact Mass | 489.20 |
| IUPAC Name | 5-[2-(4-aminophenyl)ethyl]-3-[3-tert-butyl-4-(hydroxymethyl)-5-methylthiophen-2-yl]sulfanyl-6-propan-2-yloxane-2,4-dione |
| SMILES | Cc1sc(SC2C(=O)OC(C(C)C)C(CCc3ccc(N)cc3)C2=O)c(C(C)(C)C)c1CO |
| InChI | InChI=1S/C26H35NO4S2/c1-14(2)22-18(12-9-16-7-10-17(27)11-8-16)21(29)23(24(30)31-22)33-25-20(26(4,5)6)19(13-28)15(3)32-25/h7-8,10-11,14,18,22-23,28H,9,12-13,27H2,1-6H3 |
| InChIKey | COICRHNERBVFDY-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.70 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|